CAS 1090815-16-9 is the registry number for N-Cyclopropyl 4-chloropicolinamide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 1g, 5g.
4-chloro-N-cyclopropylpyridine-2-carboxamide (CAS 1090815-16-9) is a chemical compound with the molecular formula C9H9ClN2O and a molecular weight of 196.63 g/mol. IUPAC name: 4-chloro-N-cyclopropylpyridine-2-carboxamide. InChIKey: BIBWPAZILMLFNO-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2O |
|---|---|
| Molecular weight | 196.63 g/mol |
| IUPAC name | 4-chloro-N-cyclopropylpyridine-2-carboxamide |
| InChIKey | BIBWPAZILMLFNO-UHFFFAOYSA-N |
| SMILES | C1CC1NC(=O)C2=NC=CC(=C2)Cl |
Computed by PubChem (NCBI)