CAS 1090892-67-3 is the registry number for 4-(Benzo[d][1,3]dioxol-5-yloxy)-6-chloropyrimidin-5-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(1,3-benzodioxol-5-yloxy)-6-chloropyrimidin-5-amine (CAS 1090892-67-3) is a chemical compound with the molecular formula C11H8ClN3O3 and a molecular weight of 265.65 g/mol. IUPAC name: 4-(1,3-benzodioxol-5-yloxy)-6-chloropyrimidin-5-amine. InChIKey: OFLHMQGTWSRHLR-UHFFFAOYSA-N.
| Molecular formula | C11H8ClN3O3 |
|---|---|
| Molecular weight | 265.65 g/mol |
| IUPAC name | 4-(1,3-benzodioxol-5-yloxy)-6-chloropyrimidin-5-amine |
| InChIKey | OFLHMQGTWSRHLR-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)OC3=C(C(=NC=N3)Cl)N |
Computed by PubChem (NCBI)