CAS 392694-09-6 is the registry number for 5-(((3-chlorophenyl)amino)methylene)-1,3-diazaperhydroine-2,4,6-trione. Offered by: Biosynth. Available pack sizes: 250mg.
5-[(3-chlorophenyl)iminomethyl]-6-hydroxy-1H-pyrimidine-2,4-dione (CAS 392694-09-6) is a chemical compound with the molecular formula C11H8ClN3O3 and a molecular weight of 265.65 g/mol. IUPAC name: 5-[(3-chlorophenyl)iminomethyl]-6-hydroxy-1H-pyrimidine-2,4-dione. InChIKey: DYXFHDPTYKKJRI-UHFFFAOYSA-N.
| Molecular formula | C11H8ClN3O3 |
|---|---|
| Molecular weight | 265.65 g/mol |
| IUPAC name | 5-[(3-chlorophenyl)iminomethyl]-6-hydroxy-1H-pyrimidine-2,4-dione |
| InChIKey | DYXFHDPTYKKJRI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)N=CC2=C(NC(=O)NC2=O)O |
Computed by PubChem (NCBI)