CAS 109175-64-6 appears in our catalog under these names: D–Glyceric acid sodium, D-Glyceric acid (sodium), 99.0%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 5mg, 5 mg, 10 mg.
Sodium (2R)-2,3-dihydroxypropanoate (CAS 109175-64-6) is a chemical compound with the molecular formula C3H5NaO4 and a molecular weight of 128.06 g/mol. IUPAC name: sodium (2R)-2,3-dihydroxypropanoate. InChIKey: IUEMQUIQAPPJDL-HSHFZTNMSA-M.
| Molecular formula | C3H5NaO4 |
|---|---|
| Molecular weight | 128.06 g/mol |
| IUPAC name | sodium (2R)-2,3-dihydroxypropanoate |
| InChIKey | IUEMQUIQAPPJDL-HSHFZTNMSA-M |
| SMILES | C([C@H](C(=O)[O-])O)O.[Na+] |
Computed by PubChem (NCBI)