CAS 146298-95-5 appears in our catalog under these names: L-Glyceric acid (sodium), ≥95%, ≥95%, L–Glyceric acid sodium , L-Glyceric acid sodium, 98+%, L-Glyceric acid (sodium), 99.0%. Offered by: Chemat, GLPBio, AmBeed, MedChemExpress. Available pack sizes: 10mg, 50mg, 250mg, 5mg, 1mg, 25mg, 5 mg, 10 mg.
Sodium (2S)-2,3-dihydroxypropanoate (CAS 146298-95-5) is a chemical compound with the molecular formula C3H5NaO4 and a molecular weight of 128.06 g/mol. IUPAC name: sodium (2S)-2,3-dihydroxypropanoate. InChIKey: IUEMQUIQAPPJDL-DKWTVANSSA-M.
| Molecular formula | C3H5NaO4 |
|---|---|
| Molecular weight | 128.06 g/mol |
| IUPAC name | sodium (2S)-2,3-dihydroxypropanoate |
| InChIKey | IUEMQUIQAPPJDL-DKWTVANSSA-M |
| SMILES | C([C@@H](C(=O)[O-])O)O.[Na+] |
Computed by PubChem (NCBI)