CAS 1092069-98-1 is the registry number for 2-Chloro-4,6-dimethoxyaniline Hydrochloride. Offered by: TRC. Available pack sizes: 1g, 250mg, 500mg.
2-chloro-4,6-dimethoxyaniline;hydrochloride (CAS 1092069-98-1) is a chemical compound with the molecular formula C8H11Cl2NO2 and a molecular weight of 224.08 g/mol. IUPAC name: 2-chloro-4,6-dimethoxyaniline;hydrochloride. InChIKey: SXNGROFGULBEFE-UHFFFAOYSA-N.
| Molecular formula | C8H11Cl2NO2 |
|---|---|
| Molecular weight | 224.08 g/mol |
| IUPAC name | 2-chloro-4,6-dimethoxyaniline;hydrochloride |
| InChIKey | SXNGROFGULBEFE-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)Cl)N)OC.Cl |
Computed by PubChem (NCBI)