CAS 861609-76-9 appears in our catalog under these names: 2-Chloro-4,5-dimethoxyaniline hydrochloride, 95%, 2-Chloro-4,5-dimethoxyaniline hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2-chloro-4,5-dimethoxyaniline;hydrochloride (CAS 861609-76-9) is a chemical compound with the molecular formula C8H11Cl2NO2 and a molecular weight of 224.08 g/mol. IUPAC name: 2-chloro-4,5-dimethoxyaniline;hydrochloride. InChIKey: URBHLUDGKCEVLH-UHFFFAOYSA-N.
| Molecular formula | C8H11Cl2NO2 |
|---|---|
| Molecular weight | 224.08 g/mol |
| IUPAC name | 2-chloro-4,5-dimethoxyaniline;hydrochloride |
| InChIKey | URBHLUDGKCEVLH-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)N)Cl)OC.Cl |
Computed by PubChem (NCBI)