CAS 1092287-15-4 appears in our catalog under these names: 5-((Methylsulfonyl)methyl)furan-2-carboxylic acid, 95%, 5-(Methanesulfonylmethyl)furan-2-carboxylic acid, 5-((methylsulfonyl)methyl)furan-2-carboxylic acid, 95%, 95%. Offered by: AmBeed, Biosynth, Chemat. Available pack sizes: 5g, 100mg, 1g, 250mg.
5-(methylsulfonylmethyl)furan-2-carboxylic acid (CAS 1092287-15-4) is a chemical compound with the molecular formula C7H8O5S and a molecular weight of 204.20 g/mol. IUPAC name: 5-(methylsulfonylmethyl)furan-2-carboxylic acid. InChIKey: QNSYEJUUFPWONC-UHFFFAOYSA-N.
| Molecular formula | C7H8O5S |
|---|---|
| Molecular weight | 204.20 g/mol |
| IUPAC name | 5-(methylsulfonylmethyl)furan-2-carboxylic acid |
| InChIKey | QNSYEJUUFPWONC-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)CC1=CC=C(O1)C(=O)O |
Computed by PubChem (NCBI)