Products 2429952-18-9

CAS 2429952-18-9 is the registry number for Calcium Dobesilate Impurity 2. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 2,5-dihydroxybenzenesulfonate (CAS 2429952-18-9) is a chemical compound with the molecular formula C7H8O5S and a molecular weight of 204.20 g/mol. IUPAC name: methyl 2,5-dihydroxybenzenesulfonate. InChIKey: HIENUKMMFKKBPS-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8O5S
Molecular weight204.20 g/mol
IUPAC namemethyl 2,5-dihydroxybenzenesulfonate
InChIKeyHIENUKMMFKKBPS-UHFFFAOYSA-N
SMILESCOS(=O)(=O)C1=C(C=CC(=C1)O)O

Computed by PubChem (NCBI)