CAS 2429952-18-9 is the registry number for Calcium Dobesilate Impurity 2. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2,5-dihydroxybenzenesulfonate (CAS 2429952-18-9) is a chemical compound with the molecular formula C7H8O5S and a molecular weight of 204.20 g/mol. IUPAC name: methyl 2,5-dihydroxybenzenesulfonate. InChIKey: HIENUKMMFKKBPS-UHFFFAOYSA-N.
| Molecular formula | C7H8O5S |
|---|---|
| Molecular weight | 204.20 g/mol |
| IUPAC name | methyl 2,5-dihydroxybenzenesulfonate |
| InChIKey | HIENUKMMFKKBPS-UHFFFAOYSA-N |
| SMILES | COS(=O)(=O)C1=C(C=CC(=C1)O)O |
Computed by PubChem (NCBI)