Products 1092287-40-5
CAS 1092287-40-5 appears in our catalog under these names: 2-Chloroquinoline-7-carboxylic acid, 95+%, 2-Chloroquinoline-7-carboxylic acid, 2-Chloroquinoline-7-carboxylic acid 95+%, 2-Chloroquinoline-7-carboxylic acid, 95+%, 95+%. Offered by: AmBeed, Biosynth, Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 50mg, 0,5g, 100mg.
2-chloroquinoline-7-carboxylic acid (CAS 1092287-40-5) is a chemical compound with the molecular formula C10H6ClNO2 and a molecular weight of 207.61 g/mol. IUPAC name: 2-chloroquinoline-7-carboxylic acid. InChIKey: JMYHAUFFRDHDQS-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNO2 |
|---|---|
| Molecular weight | 207.61 g/mol |
| IUPAC name | 2-chloroquinoline-7-carboxylic acid |
| InChIKey | JMYHAUFFRDHDQS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C1C=CC(=N2)Cl)C(=O)O |
Computed by PubChem (NCBI)