CAS 1092301-39-7 is the registry number for 2-Methyl-7-phenylthiazolo[4,5-d]pyridazine-4-thiol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-methyl-7-phenyl-5H-[1,3]thiazolo[4,5-d]pyridazine-4-thione (CAS 1092301-39-7) is a chemical compound with the molecular formula C12H9N3S2 and a molecular weight of 259.4 g/mol. IUPAC name: 2-methyl-7-phenyl-5H-[1,3]thiazolo[4,5-d]pyridazine-4-thione. InChIKey: FZSTWOJZJWJQAV-UHFFFAOYSA-N.
| Molecular formula | C12H9N3S2 |
|---|---|
| Molecular weight | 259.4 g/mol |
| IUPAC name | 2-methyl-7-phenyl-5H-[1,3]thiazolo[4,5-d]pyridazine-4-thione |
| InChIKey | FZSTWOJZJWJQAV-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(S1)C(=NNC2=S)C3=CC=CC=C3 |
Computed by PubChem (NCBI)