CAS 57600-04-1 appears in our catalog under these names: 4-Phenyl-5-(2-thienyl)-4H-1,2,4-triazol-3-ylhydrosulfide, 95%, 4-Phenyl-5-(thiophen-2-yl)-4H-1,2,4-triazole-3-thiol, 95+%, 4-phenyl-3-(2-thienyl)-1,2,4-triazoline-5-thione 98%, 98%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 25g, 1g, 5g, 10g, 2g.
4-phenyl-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione (CAS 57600-04-1) is a chemical compound with the molecular formula C12H9N3S2 and a molecular weight of 259.4 g/mol. IUPAC name: 4-phenyl-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione. InChIKey: SCZDETZAWGOQLX-UHFFFAOYSA-N.
| Molecular formula | C12H9N3S2 |
|---|---|
| Molecular weight | 259.4 g/mol |
| IUPAC name | 4-phenyl-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione |
| InChIKey | SCZDETZAWGOQLX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=NNC2=S)C3=CC=CS3 |
Computed by PubChem (NCBI)