CAS 1092345-30-6 is the registry number for Methyl 1-((3-chlorophenyl)methyl)-2-ethyl-5-methoxy-1H-indole-3-carboxylate. Offered by: Biosynth. Available pack sizes: 1000mg.
Methyl 1-[(3-chlorophenyl)methyl]-2-ethyl-5-methoxyindole-3-carboxylate (CAS 1092345-30-6) is a chemical compound with the molecular formula C20H20ClNO3 and a molecular weight of 357.8 g/mol. IUPAC name: methyl 1-[(3-chlorophenyl)methyl]-2-ethyl-5-methoxyindole-3-carboxylate. InChIKey: MSQQCAPQFQMYSY-UHFFFAOYSA-N.
| Molecular formula | C20H20ClNO3 |
|---|---|
| Molecular weight | 357.8 g/mol |
| IUPAC name | methyl 1-[(3-chlorophenyl)methyl]-2-ethyl-5-methoxyindole-3-carboxylate |
| InChIKey | MSQQCAPQFQMYSY-UHFFFAOYSA-N |
| SMILES | CCC1=C(C2=C(N1CC3=CC(=CC=C3)Cl)C=CC(=C2)OC)C(=O)OC |
Computed by PubChem (NCBI)