CAS 1820712-06-8 is the registry number for methyl 2-chloro-4-{4-[(piperidin-1-yl)carbonyl]phenyl}benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Methyl 2-chloro-4-[4-(piperidine-1-carbonyl)phenyl]benzoate (CAS 1820712-06-8) is a chemical compound with the molecular formula C20H20ClNO3 and a molecular weight of 357.8 g/mol. IUPAC name: methyl 2-chloro-4-[4-(piperidine-1-carbonyl)phenyl]benzoate. InChIKey: ZUCMHQQIXQHBHV-UHFFFAOYSA-N.
| Molecular formula | C20H20ClNO3 |
|---|---|
| Molecular weight | 357.8 g/mol |
| IUPAC name | methyl 2-chloro-4-[4-(piperidine-1-carbonyl)phenyl]benzoate |
| InChIKey | ZUCMHQQIXQHBHV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)C2=CC=C(C=C2)C(=O)N3CCCCC3)Cl |
Computed by PubChem (NCBI)