Products 1820712-06-8

CAS 1820712-06-8 is the registry number for methyl 2-chloro-4-{4-[(piperidin-1-yl)carbonyl]phenyl}benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Methyl 2-chloro-4-[4-(piperidine-1-carbonyl)phenyl]benzoate (CAS 1820712-06-8) is a chemical compound with the molecular formula C20H20ClNO3 and a molecular weight of 357.8 g/mol. IUPAC name: methyl 2-chloro-4-[4-(piperidine-1-carbonyl)phenyl]benzoate. InChIKey: ZUCMHQQIXQHBHV-UHFFFAOYSA-N.

Identity
Molecular formulaC20H20ClNO3
Molecular weight357.8 g/mol
IUPAC namemethyl 2-chloro-4-[4-(piperidine-1-carbonyl)phenyl]benzoate
InChIKeyZUCMHQQIXQHBHV-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C=C(C=C1)C2=CC=C(C=C2)C(=O)N3CCCCC3)Cl

Computed by PubChem (NCBI)