CAS 1092350-32-7 is the registry number for 2-Bromo-3,5-dichloro-4-fluoroaniline, 98%. Offered by: Fluorochem. Available pack sizes: 250mg, 1g, 5g.
2-bromo-3,5-dichloro-4-fluoroaniline (CAS 1092350-32-7) is a chemical compound with the molecular formula C6H3BrCl2FN and a molecular weight of 258.90 g/mol. IUPAC name: 2-bromo-3,5-dichloro-4-fluoroaniline. InChIKey: DNENFPKVWBEPBD-UHFFFAOYSA-N.
| Molecular formula | C6H3BrCl2FN |
|---|---|
| Molecular weight | 258.90 g/mol |
| IUPAC name | 2-bromo-3,5-dichloro-4-fluoroaniline |
| InChIKey | DNENFPKVWBEPBD-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Cl)F)Cl)Br)N |
Computed by PubChem (NCBI)