CAS 1360438-57-8 is the registry number for 6-Bromo-2,4-dichloro-3-fluoroaniline, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6-bromo-2,4-dichloro-3-fluoroaniline (CAS 1360438-57-8) is a chemical compound with the molecular formula C6H3BrCl2FN and a molecular weight of 258.90 g/mol. IUPAC name: 6-bromo-2,4-dichloro-3-fluoroaniline. InChIKey: BMJSXDVLJRTVSG-UHFFFAOYSA-N.
| Molecular formula | C6H3BrCl2FN |
|---|---|
| Molecular weight | 258.90 g/mol |
| IUPAC name | 6-bromo-2,4-dichloro-3-fluoroaniline |
| InChIKey | BMJSXDVLJRTVSG-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)N)Cl)F)Cl |
Computed by PubChem (NCBI)