CAS 1092352-36-7 appears in our catalog under these names: 2-Ethylquinoline-4,6-diamine, 95%, 2-Ethylquinoline-4,6-diamine, 97%, 2-Ethylquinoline-4,6-diamine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 5g, 50mg, 0,5g.
2-ethylquinoline-4,6-diamine (CAS 1092352-36-7) is a chemical compound with the molecular formula C11H13N3 and a molecular weight of 187.24 g/mol. IUPAC name: 2-ethylquinoline-4,6-diamine. InChIKey: AISUEAAFEZCUCS-UHFFFAOYSA-N.
| Molecular formula | C11H13N3 |
|---|---|
| Molecular weight | 187.24 g/mol |
| IUPAC name | 2-ethylquinoline-4,6-diamine |
| InChIKey | AISUEAAFEZCUCS-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=C2C=C(C=CC2=N1)N)N |
Computed by PubChem (NCBI)