Products 1092400-82-2
CAS 1092400-82-2 appears in our catalog under these names: 3-(5-(Trifluoromethyl)-1,2,4-Oxadiazol-3-yl)Benzoic Acid, 98%, 98%, 3-(5-(Trifluoromethyl)-1,2,4-oxadiazol-3-yl)benzoic acid, 97%, 3-(5-(Trifluoromethyl)-1,2,4-oxadiazol-3-yl)benzoic acid, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 25g.
3-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzoic acid (CAS 1092400-82-2) is a chemical compound with the molecular formula C10H5F3N2O3 and a molecular weight of 258.15 g/mol. IUPAC name: 3-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzoic acid. InChIKey: ZTOAUVQUTVRHBJ-UHFFFAOYSA-N.
| Molecular formula | C10H5F3N2O3 |
|---|---|
| Molecular weight | 258.15 g/mol |
| IUPAC name | 3-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzoic acid |
| InChIKey | ZTOAUVQUTVRHBJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C2=NOC(=N2)C(F)(F)F |
Computed by PubChem (NCBI)