CAS 340736-76-7 appears in our catalog under these names: 4-(5-Trifluoromethyl-1,2,4-oxadiazol-3-yl)-benzoic Acid, 4–(5–(Trifluoromethyl)–1,2,4–oxadiazol–3–yl)benzoic acid, 4-(5-(Trifluoromethyl)-1,2,4-oxadiazol-3-yl)benzoic acid, 95%, 95%, 4-(5-(Trifluoromethyl)-1,2,4-oxadiazol-3-yl)benzoic acid, 97%. Offered by: TRC, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 10mg, 25mg, 1g, 5g, 250mg, 10g, 25g.
4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzoic acid (CAS 340736-76-7) is a chemical compound with the molecular formula C10H5F3N2O3 and a molecular weight of 258.15 g/mol. IUPAC name: 4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzoic acid. InChIKey: WJQLFPSEXHEXRM-UHFFFAOYSA-N.
| Molecular formula | C10H5F3N2O3 |
|---|---|
| Molecular weight | 258.15 g/mol |
| IUPAC name | 4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzoic acid |
| InChIKey | WJQLFPSEXHEXRM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NOC(=N2)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)