CAS 1092460-60-0 appears in our catalog under these names: 3-Ethoxy-2,6-difluorobenzonitrile, 95%, 3-Ethoxy-2,6-difluorobenzonitrile, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 5g.
3-ethoxy-2,6-difluorobenzonitrile (CAS 1092460-60-0) is a chemical compound with the molecular formula C9H7F2NO and a molecular weight of 183.15 g/mol. IUPAC name: 3-ethoxy-2,6-difluorobenzonitrile. InChIKey: DXDVVERIUVEESC-UHFFFAOYSA-N.
| Molecular formula | C9H7F2NO |
|---|---|
| Molecular weight | 183.15 g/mol |
| IUPAC name | 3-ethoxy-2,6-difluorobenzonitrile |
| InChIKey | DXDVVERIUVEESC-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=C(C=C1)F)C#N)F |
Computed by PubChem (NCBI)