CAS 886499-03-2 appears in our catalog under these names: 2-(2,6-Difluoro-4-methoxyphenyl)acetonitrile, 95+%, 2,6-Difluoro-4-methoxyphenylacetonitrile, 95%, 2,6-Difluoro-4-methoxyphenylacetonitrile. Offered by: AmBeed, Combi-blocks, Biosynth. Available pack sizes: 25g, 250mg, 1g, 2,5g.
2-(2,6-difluoro-4-methoxyphenyl)acetonitrile (CAS 886499-03-2) is a chemical compound with the molecular formula C9H7F2NO and a molecular weight of 183.15 g/mol. IUPAC name: 2-(2,6-difluoro-4-methoxyphenyl)acetonitrile. InChIKey: QIAUDGXIPNBTDC-UHFFFAOYSA-N.
| Molecular formula | C9H7F2NO |
|---|---|
| Molecular weight | 183.15 g/mol |
| IUPAC name | 2-(2,6-difluoro-4-methoxyphenyl)acetonitrile |
| InChIKey | QIAUDGXIPNBTDC-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)F)CC#N)F |
Computed by PubChem (NCBI)