Products 1092484-57-5
CAS 1092484-57-5 is the registry number for Fenofibrate-d4. Offered by: MedChemExpress. Available pack sizes: 1 mg.
Propan-2-yl 2-[4-(4-chlorobenzoyl)-2,3,5,6-tetradeuteriophenoxy]-2-methylpropanoate (CAS 1092484-57-5) is a chemical compound with the molecular formula C20H21ClO4 and a molecular weight of 364.9 g/mol. IUPAC name: propan-2-yl 2-[4-(4-chlorobenzoyl)-2,3,5,6-tetradeuteriophenoxy]-2-methylpropanoate. InChIKey: YMTINGFKWWXKFG-CXRURWBMSA-N.
| Molecular formula | C20H21ClO4 |
|---|---|
| Molecular weight | 364.9 g/mol |
| IUPAC name | propan-2-yl 2-[4-(4-chlorobenzoyl)-2,3,5,6-tetradeuteriophenoxy]-2-methylpropanoate |
| InChIKey | YMTINGFKWWXKFG-CXRURWBMSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C(=O)C2=CC=C(C=C2)Cl)[2H])[2H])OC(C)(C)C(=O)OC(C)C)[2H] |
Computed by PubChem (NCBI)