Products 1092540-48-1
CAS 1092540-48-1 appears in our catalog under these names: 3-(Methyl-d3)-L-Valine-4,4,4,4',4',4'-d6 Hydrochloride, L–tert–Leucine–d9 hydrochloride. Offered by: Chemat Brand, TRC, GLPBio. Available pack sizes: on request, 500mg, 250mg, 50mg.
(2S)-2-amino-4,4,4-trideuterio-3,3-bis(trideuteriomethyl)butanoic acid;hydrochloride (CAS 1092540-48-1) is a chemical compound with the molecular formula C6H14ClNO2 and a molecular weight of 176.69 g/mol. IUPAC name: (2S)-2-amino-4,4,4-trideuterio-3,3-bis(trideuteriomethyl)butanoic acid;hydrochloride. InChIKey: OLMBOHVAVKHHTK-JITNTYNXSA-N.
| Molecular formula | C6H14ClNO2 |
|---|---|
| Molecular weight | 176.69 g/mol |
| IUPAC name | (2S)-2-amino-4,4,4-trideuterio-3,3-bis(trideuteriomethyl)butanoic acid;hydrochloride |
| InChIKey | OLMBOHVAVKHHTK-JITNTYNXSA-N |
| SMILES | [2H]C([2H])([2H])C([C@@H](C(=O)O)N)(C([2H])([2H])[2H])C([2H])([2H])[2H].Cl |
Computed by PubChem (NCBI)