CAS 139163-43-2 appears in our catalog under these names: (S)-2-Amino-3,3-dimethylbutanoic acid hydrochloride, 95%, H–Tle–OH·HCl, H-tert-Leu-OH·HCl 95%, (S)-2-Amino-3,3-dimethylbutanoic acid hydrochloride, 95%, 95%. Offered by: Fluorochem, GLPBio, Ambeed, Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 10g.
(2S)-2-amino-3,3-dimethylbutanoic acid;hydrochloride (CAS 139163-43-2) is a chemical compound with the molecular formula C6H14ClNO2 and a molecular weight of 167.63 g/mol. IUPAC name: (2S)-2-amino-3,3-dimethylbutanoic acid;hydrochloride. InChIKey: OLMBOHVAVKHHTK-PGMHMLKASA-N.
| Molecular formula | C6H14ClNO2 |
|---|---|
| Molecular weight | 167.63 g/mol |
| IUPAC name | (2S)-2-amino-3,3-dimethylbutanoic acid;hydrochloride |
| InChIKey | OLMBOHVAVKHHTK-PGMHMLKASA-N |
| SMILES | CC(C)(C)[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)