CAS 1092563-28-4 is the registry number for Thiomorpholine, 4-[(4-bromo-2-fluorophenyl)methyl]-, 1,1-dioxide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-[(4-bromo-2-fluorophenyl)methyl]-1,4-thiazinane 1,1-dioxide (CAS 1092563-28-4) is a chemical compound with the molecular formula C11H13BrFNO2S and a molecular weight of 322.20 g/mol. IUPAC name: 4-[(4-bromo-2-fluorophenyl)methyl]-1,4-thiazinane 1,1-dioxide. InChIKey: NKWZNVBXWZCTDM-UHFFFAOYSA-N.
| Molecular formula | C11H13BrFNO2S |
|---|---|
| Molecular weight | 322.20 g/mol |
| IUPAC name | 4-[(4-bromo-2-fluorophenyl)methyl]-1,4-thiazinane 1,1-dioxide |
| InChIKey | NKWZNVBXWZCTDM-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCN1CC2=C(C=C(C=C2)Br)F |
Computed by PubChem (NCBI)