CAS 1973485-27-6 appears in our catalog under these names: 4-[(4-Bromo-3-fluorophenyl)methyl]-1-thiomorpholine-1,1-dione, 95%, 4-[(4-BROMO-3-FLUOROPHENYL)METHYL]-1-THIOMORPHOLINE-1,1-DIONE, 97%, 97%, 4-(4-Bromo-3-fluorobenzyl)thiomorpholine 1,1-dioxide, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 25g, 100g.
4-[(4-bromo-3-fluorophenyl)methyl]-1,4-thiazinane 1,1-dioxide (CAS 1973485-27-6) is a chemical compound with the molecular formula C11H13BrFNO2S and a molecular weight of 322.20 g/mol. IUPAC name: 4-[(4-bromo-3-fluorophenyl)methyl]-1,4-thiazinane 1,1-dioxide. InChIKey: BIIMHCMVLWTMGK-UHFFFAOYSA-N.
| Molecular formula | C11H13BrFNO2S |
|---|---|
| Molecular weight | 322.20 g/mol |
| IUPAC name | 4-[(4-bromo-3-fluorophenyl)methyl]-1,4-thiazinane 1,1-dioxide |
| InChIKey | BIIMHCMVLWTMGK-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCN1CC2=CC(=C(C=C2)Br)F |
Computed by PubChem (NCBI)