CAS 1092563-51-3 is the registry number for (4-Bromo-2-methyl-phenyl)-(4-ethyl-piperazin-1-yl)-methanone, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
(4-bromo-2-methylphenyl)-(4-ethylpiperazin-1-yl)methanone (CAS 1092563-51-3) is a chemical compound with the molecular formula C14H19BrN2O and a molecular weight of 311.22 g/mol. IUPAC name: (4-bromo-2-methylphenyl)-(4-ethylpiperazin-1-yl)methanone. InChIKey: MGMIHUVKOQWPEN-UHFFFAOYSA-N.
| Molecular formula | C14H19BrN2O |
|---|---|
| Molecular weight | 311.22 g/mol |
| IUPAC name | (4-bromo-2-methylphenyl)-(4-ethylpiperazin-1-yl)methanone |
| InChIKey | MGMIHUVKOQWPEN-UHFFFAOYSA-N |
| SMILES | CCN1CCN(CC1)C(=O)C2=C(C=C(C=C2)Br)C |
Computed by PubChem (NCBI)