CAS 1314985-53-9 is the registry number for 5-Bromo-1-t-butyl-6-propoxybenzimidazole, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
5-bromo-1-tert-butyl-6-propoxybenzimidazole (CAS 1314985-53-9) is a chemical compound with the molecular formula C14H19BrN2O and a molecular weight of 311.22 g/mol. IUPAC name: 5-bromo-1-tert-butyl-6-propoxybenzimidazole. InChIKey: IAJJHJVNODDTOT-UHFFFAOYSA-N.
| Molecular formula | C14H19BrN2O |
|---|---|
| Molecular weight | 311.22 g/mol |
| IUPAC name | 5-bromo-1-tert-butyl-6-propoxybenzimidazole |
| InChIKey | IAJJHJVNODDTOT-UHFFFAOYSA-N |
| SMILES | CCCOC1=C(C=C2C(=C1)N(C=N2)C(C)(C)C)Br |
Computed by PubChem (NCBI)