CAS 1092649-16-5 is the registry number for 4-(2-Aminoethyl)-cis-2,6-dimethylmorpholine, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]ethanamine (CAS 1092649-16-5) is a chemical compound with the molecular formula C8H18N2O and a molecular weight of 158.24 g/mol. IUPAC name: 2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]ethanamine. InChIKey: GLOJLKCUVTZRFO-OCAPTIKFSA-N.
| Molecular formula | C8H18N2O |
|---|---|
| Molecular weight | 158.24 g/mol |
| IUPAC name | 2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]ethanamine |
| InChIKey | GLOJLKCUVTZRFO-OCAPTIKFSA-N |
| SMILES | C[C@@H]1CN(C[C@@H](O1)C)CCN |
Computed by PubChem (NCBI)