Products 1092774-03-2

CAS 1092774-03-2 is the registry number for Methyl 5-(4-(difluoromethoxy)phenyl)-1H-pyrazole-3-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.

Structural formula: {0} (CAS {1})

Methyl 3-[4-(difluoromethoxy)phenyl]-1H-pyrazole-5-carboxylate (CAS 1092774-03-2) is a chemical compound with the molecular formula C12H10F2N2O3 and a molecular weight of 268.22 g/mol. IUPAC name: methyl 3-[4-(difluoromethoxy)phenyl]-1H-pyrazole-5-carboxylate. InChIKey: DOPNRGJEIISYDG-UHFFFAOYSA-N.

Identity
Molecular formulaC12H10F2N2O3
Molecular weight268.22 g/mol
IUPAC namemethyl 3-[4-(difluoromethoxy)phenyl]-1H-pyrazole-5-carboxylate
InChIKeyDOPNRGJEIISYDG-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC(=NN1)C2=CC=C(C=C2)OC(F)F

Computed by PubChem (NCBI)