CAS 1290707-67-3 is the registry number for Ethyl 3-(3,5-difluorobenzyl)-1,2,4-oxadiazole-5-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 3-[(3,5-difluorophenyl)methyl]-1,2,4-oxadiazole-5-carboxylate (CAS 1290707-67-3) is a chemical compound with the molecular formula C12H10F2N2O3 and a molecular weight of 268.22 g/mol. IUPAC name: ethyl 3-[(3,5-difluorophenyl)methyl]-1,2,4-oxadiazole-5-carboxylate. InChIKey: HHYJCXZZWRDARB-UHFFFAOYSA-N.
| Molecular formula | C12H10F2N2O3 |
|---|---|
| Molecular weight | 268.22 g/mol |
| IUPAC name | ethyl 3-[(3,5-difluorophenyl)methyl]-1,2,4-oxadiazole-5-carboxylate |
| InChIKey | HHYJCXZZWRDARB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC(=NO1)CC2=CC(=CC(=C2)F)F |
Computed by PubChem (NCBI)