CAS 1092801-83-6 is the registry number for 2-(Benzyloxy)-7-phenylisoquinoline-1,3(2H,4H)-dione. Offered by: Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg.
7-phenyl-2-phenylmethoxy-4H-isoquinoline-1,3-dione (CAS 1092801-83-6) is a chemical compound with the molecular formula C22H17NO3 and a molecular weight of 343.4 g/mol. IUPAC name: 7-phenyl-2-phenylmethoxy-4H-isoquinoline-1,3-dione. InChIKey: CRDJJFZRUUIJTJ-UHFFFAOYSA-N.
| Molecular formula | C22H17NO3 |
|---|---|
| Molecular weight | 343.4 g/mol |
| IUPAC name | 7-phenyl-2-phenylmethoxy-4H-isoquinoline-1,3-dione |
| InChIKey | CRDJJFZRUUIJTJ-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=C(C=C2)C3=CC=CC=C3)C(=O)N(C1=O)OCC4=CC=CC=C4 |
Computed by PubChem (NCBI)