Products 1451369-32-6
CAS 1451369-32-6 appears in our catalog under these names: JWH 018 N–propanoic acid metabolite, 3-(3-(Naphthalene-1-carbonyl)indol-1-yl)propanoic acid. Offered by: GLPBio, Biosynth. Available pack sizes: 1mg, 10mg, 5mg, 50mg, 25mg.
3-[3-(naphthalene-1-carbonyl)indol-1-yl]propanoic acid (CAS 1451369-32-6) is a chemical compound with the molecular formula C22H17NO3 and a molecular weight of 343.4 g/mol. IUPAC name: 3-[3-(naphthalene-1-carbonyl)indol-1-yl]propanoic acid. InChIKey: VCRZMEAJRGIGCT-UHFFFAOYSA-N.
| Molecular formula | C22H17NO3 |
|---|---|
| Molecular weight | 343.4 g/mol |
| IUPAC name | 3-[3-(naphthalene-1-carbonyl)indol-1-yl]propanoic acid |
| InChIKey | VCRZMEAJRGIGCT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C(=O)C3=CN(C4=CC=CC=C43)CCC(=O)O |
Computed by PubChem (NCBI)