CAS 109292-89-9 is the registry number for 2,5-Dichloro-1,3-benzenedicarbonitrile. Offered by: TRC. Available pack sizes: 10mg.
2,5-dichlorobenzene-1,3-dicarbonitrile (CAS 109292-89-9) is a chemical compound with the molecular formula C8H2Cl2N2 and a molecular weight of 197.02 g/mol. IUPAC name: 2,5-dichlorobenzene-1,3-dicarbonitrile. InChIKey: CNHBUKOQNKTNEU-UHFFFAOYSA-N.
| Molecular formula | C8H2Cl2N2 |
|---|---|
| Molecular weight | 197.02 g/mol |
| IUPAC name | 2,5-dichlorobenzene-1,3-dicarbonitrile |
| InChIKey | CNHBUKOQNKTNEU-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C#N)Cl)C#N)Cl |
Computed by PubChem (NCBI)