CAS 1897-44-5 is the registry number for 4,6-Dichloroisophthalonitrile, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
4,6-dichlorobenzene-1,3-dicarbonitrile (CAS 1897-44-5) is a chemical compound with the molecular formula C8H2Cl2N2 and a molecular weight of 197.02 g/mol. IUPAC name: 4,6-dichlorobenzene-1,3-dicarbonitrile. InChIKey: WMRVCOCGHLAIED-UHFFFAOYSA-N.
| Molecular formula | C8H2Cl2N2 |
|---|---|
| Molecular weight | 197.02 g/mol |
| IUPAC name | 4,6-dichlorobenzene-1,3-dicarbonitrile |
| InChIKey | WMRVCOCGHLAIED-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1C#N)Cl)Cl)C#N |
Computed by PubChem (NCBI)