Products 1092965-77-9
CAS 1092965-77-9 appears in our catalog under these names: trans-beta-Farnesene-D6, (E)-β-Farnesene-d6. Offered by: TRC, MedChemExpress. Available pack sizes: 50mg, 1 mg.
(6E)-12,12,12-trideuterio-7-methyl-3-methylidene-11-(trideuteriomethyl)dodeca-1,6,10-triene (CAS 1092965-77-9) is a chemical compound with the molecular formula C15H24 and a molecular weight of 210.39 g/mol. IUPAC name: (6E)-12,12,12-trideuterio-7-methyl-3-methylidene-11-(trideuteriomethyl)dodeca-1,6,10-triene. InChIKey: JSNRRGGBADWTMC-PBPWFUBNSA-N.
| Molecular formula | C15H24 |
|---|---|
| Molecular weight | 210.39 g/mol |
| IUPAC name | (6E)-12,12,12-trideuterio-7-methyl-3-methylidene-11-(trideuteriomethyl)dodeca-1,6,10-triene |
| InChIKey | JSNRRGGBADWTMC-PBPWFUBNSA-N |
| SMILES | [2H]C([2H])([2H])C(=CCC/C(=C/CCC(=C)C=C)/C)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)