CAS 109304-06-5 is the registry number for 2’-Deoxy-2’-fluoroarabino-O6-methyl inosine. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R,3R,4S,5R)-4-fluoro-2-(hydroxymethyl)-5-(6-methoxypurin-9-yl)oxolan-3-ol (CAS 109304-06-5) is a chemical compound with the molecular formula C11H13FN4O4 and a molecular weight of 284.24 g/mol. IUPAC name: (2R,3R,4S,5R)-4-fluoro-2-(hydroxymethyl)-5-(6-methoxypurin-9-yl)oxolan-3-ol. InChIKey: BQLCZDLJTPAFTK-WCGPTHBMSA-N.
| Molecular formula | C11H13FN4O4 |
|---|---|
| Molecular weight | 284.24 g/mol |
| IUPAC name | (2R,3R,4S,5R)-4-fluoro-2-(hydroxymethyl)-5-(6-methoxypurin-9-yl)oxolan-3-ol |
| InChIKey | BQLCZDLJTPAFTK-WCGPTHBMSA-N |
| SMILES | COC1=NC=NC2=C1N=CN2[C@H]3[C@H]([C@@H]([C@H](O3)CO)O)F |
Computed by PubChem (NCBI)