Products 2072145-35-6
CAS 2072145-35-6 is the registry number for 6-Methoxy purine-9-beta-D-(3’-deoxy-3’-fluoro)riboside. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R,3S,4S,5R)-4-fluoro-5-(hydroxymethyl)-2-(6-methoxypurin-9-yl)oxolan-3-ol (CAS 2072145-35-6) is a chemical compound with the molecular formula C11H13FN4O4 and a molecular weight of 284.24 g/mol. IUPAC name: (2R,3S,4S,5R)-4-fluoro-5-(hydroxymethyl)-2-(6-methoxypurin-9-yl)oxolan-3-ol. InChIKey: JYAVXAIZAFVSMN-HUKYDQBMSA-N.
| Molecular formula | C11H13FN4O4 |
|---|---|
| Molecular weight | 284.24 g/mol |
| IUPAC name | (2R,3S,4S,5R)-4-fluoro-5-(hydroxymethyl)-2-(6-methoxypurin-9-yl)oxolan-3-ol |
| InChIKey | JYAVXAIZAFVSMN-HUKYDQBMSA-N |
| SMILES | COC1=NC=NC2=C1N=CN2[C@H]3[C@@H]([C@@H]([C@H](O3)CO)F)O |
Computed by PubChem (NCBI)