CAS 1093058-52-6 appears in our catalog under these names: Heme Oxygenase-1-IN-1, 99+%, Heme Oxygenase-1-IN-1/ 98.26% (existing batch purity), HO-1-in-1, Heme Oxygenase-1-IN-1, 99.13%, Heme Oxygenase-1-IN-1. Offered by: AmBeed, TargetMol, Biosynth, MedChemExpress, Chemat. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 25mg, 50mg, 500mg, 10mM/1mL.
1-[4-(4-bromophenyl)butyl]imidazole (CAS 1093058-52-6) is a chemical compound with the molecular formula C13H15BrN2 and a molecular weight of 279.18 g/mol. IUPAC name: 1-[4-(4-bromophenyl)butyl]imidazole. InChIKey: FZNINMHMRBYDPR-UHFFFAOYSA-N.
| Molecular formula | C13H15BrN2 |
|---|---|
| Molecular weight | 279.18 g/mol |
| IUPAC name | 1-[4-(4-bromophenyl)butyl]imidazole |
| InChIKey | FZNINMHMRBYDPR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CCCCN2C=CN=C2)Br |
Computed by PubChem (NCBI)