CAS 1269291-10-2 appears in our catalog under these names: 4-Bromo-1-(tert-butyl)-5-phenyl-1H-pyrazole, 95%, 4–Bromo–1–(tert–butyl)–5–phenyl–1H–pyrazole. Offered by: AmBeed, GLPBio. Available pack sizes: 250mg, 100mg, 1g.
4-bromo-1-tert-butyl-5-phenylpyrazole (CAS 1269291-10-2) is a chemical compound with the molecular formula C13H15BrN2 and a molecular weight of 279.18 g/mol. IUPAC name: 4-bromo-1-tert-butyl-5-phenylpyrazole. InChIKey: XJPZALIOQKEUGQ-UHFFFAOYSA-N.
| Molecular formula | C13H15BrN2 |
|---|---|
| Molecular weight | 279.18 g/mol |
| IUPAC name | 4-bromo-1-tert-butyl-5-phenylpyrazole |
| InChIKey | XJPZALIOQKEUGQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N1C(=C(C=N1)Br)C2=CC=CC=C2 |
Computed by PubChem (NCBI)