CAS 1093130-72-3 appears in our catalog under these names: Veledimex (INXN–1001), Veledimex, Veledimex, 98.77%, Veledimex, 99%. Offered by: GLPBio, Biosynth, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 1mg, 10mg, 5mg, 10mM (in 1ml dmso), 0,5mg, 2mg, 10 mg, 50 mg.
N'-(3,5-dimethylbenzoyl)-N'-[(3R)-2,2-dimethylhexan-3-yl]-2-ethyl-3-methoxybenzohydrazide (CAS 1093130-72-3) is a chemical compound with the molecular formula C27H38N2O3 and a molecular weight of 438.6 g/mol. IUPAC name: N'-(3,5-dimethylbenzoyl)-N'-[(3R)-2,2-dimethylhexan-3-yl]-2-ethyl-3-methoxybenzohydrazide. InChIKey: LZWZPGLVHLSWQX-XMMPIXPASA-N.
| Molecular formula | C27H38N2O3 |
|---|---|
| Molecular weight | 438.6 g/mol |
| IUPAC name | N'-(3,5-dimethylbenzoyl)-N'-[(3R)-2,2-dimethylhexan-3-yl]-2-ethyl-3-methoxybenzohydrazide |
| InChIKey | LZWZPGLVHLSWQX-XMMPIXPASA-N |
| SMILES | CCC[C@H](C(C)(C)C)N(C(=O)C1=CC(=CC(=C1)C)C)NC(=O)C2=C(C(=CC=C2)OC)CC |
Computed by PubChem (NCBI)