Products 755013-59-3
CAS 755013-59-3 is the registry number for Veledimex (racemate), 98.0%. Offered by: MedChemExpress. Available pack sizes: Get quote.
N'-(3,5-dimethylbenzoyl)-N'-(2,2-dimethylhexan-3-yl)-2-ethyl-3-methoxybenzohydrazide (CAS 755013-59-3) is a chemical compound with the molecular formula C27H38N2O3 and a molecular weight of 438.6 g/mol. IUPAC name: N'-(3,5-dimethylbenzoyl)-N'-(2,2-dimethylhexan-3-yl)-2-ethyl-3-methoxybenzohydrazide. InChIKey: LZWZPGLVHLSWQX-UHFFFAOYSA-N.
| Molecular formula | C27H38N2O3 |
|---|---|
| Molecular weight | 438.6 g/mol |
| IUPAC name | N'-(3,5-dimethylbenzoyl)-N'-(2,2-dimethylhexan-3-yl)-2-ethyl-3-methoxybenzohydrazide |
| InChIKey | LZWZPGLVHLSWQX-UHFFFAOYSA-N |
| SMILES | CCCC(C(C)(C)C)N(C(=O)C1=CC(=CC(=C1)C)C)NC(=O)C2=C(C(=CC=C2)OC)CC |
Computed by PubChem (NCBI)