Products 1093192-03-0
CAS 1093192-03-0 is the registry number for (S)-3-Methyl-3-nitro-2-(((S)-1-phenylethyl)amino)butanoic acid, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
(2S)-3-methyl-3-nitro-2-[[(1S)-1-phenylethyl]amino]butanoic acid (CAS 1093192-03-0) is a chemical compound with the molecular formula C13H18N2O4 and a molecular weight of 266.29 g/mol. IUPAC name: (2S)-3-methyl-3-nitro-2-[[(1S)-1-phenylethyl]amino]butanoic acid. InChIKey: ZHUMAKNXBGYCDQ-GXSJLCMTSA-N.
| Molecular formula | C13H18N2O4 |
|---|---|
| Molecular weight | 266.29 g/mol |
| IUPAC name | (2S)-3-methyl-3-nitro-2-[[(1S)-1-phenylethyl]amino]butanoic acid |
| InChIKey | ZHUMAKNXBGYCDQ-GXSJLCMTSA-N |
| SMILES | C[C@@H](C1=CC=CC=C1)N[C@H](C(=O)O)C(C)(C)[N+](=O)[O-] |
Computed by PubChem (NCBI)