CAS 1093192-08-5 is the registry number for L-Valine, 3-[[(1,1-dimethylethoxy)carbonyl]amino]-, methyl ester, hydrochloride (1:1), 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
Methyl (2S)-2-amino-3-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate;hydrochloride (CAS 1093192-08-5) is a chemical compound with the molecular formula C11H23ClN2O4 and a molecular weight of 282.76 g/mol. IUPAC name: methyl (2S)-2-amino-3-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate;hydrochloride. InChIKey: HIDTXISDBPYRSR-OGFXRTJISA-N.
| Molecular formula | C11H23ClN2O4 |
|---|---|
| Molecular weight | 282.76 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate;hydrochloride |
| InChIKey | HIDTXISDBPYRSR-OGFXRTJISA-N |
| SMILES | CC(C)(C)OC(=O)NC(C)(C)[C@@H](C(=O)OC)N.Cl |
Computed by PubChem (NCBI)