CAS 748150-93-8 appears in our catalog under these names: Boc-L-Ornithine Methyl Ester HCl, (S)-Methyl 5-amino-2-((tert-butoxycarbonyl)amino)pentanoate hydrochloride, (S)-Methyl 5-amino-2-((tert-butoxycarbonyl)amino)pentanoate hydrochloride, 95%, 95%. Offered by: Chemat Brand, Biosynth, Chemat. Available pack sizes: on request, 0,01g, 0,05g, 0,025g, 0,25g, 0,1g, 100mg, 250mg.
Methyl (2S)-5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate;hydrochloride (CAS 748150-93-8) is a chemical compound with the molecular formula C11H23ClN2O4 and a molecular weight of 282.76 g/mol. IUPAC name: methyl (2S)-5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate;hydrochloride. InChIKey: AFFYUUQZLRMAKG-QRPNPIFTSA-N.
| Molecular formula | C11H23ClN2O4 |
|---|---|
| Molecular weight | 282.76 g/mol |
| IUPAC name | methyl (2S)-5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate;hydrochloride |
| InChIKey | AFFYUUQZLRMAKG-QRPNPIFTSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCN)C(=O)OC.Cl |
Computed by PubChem (NCBI)