Products 1093383-16-4

CAS 1093383-16-4 is the registry number for Methyl 3-bromo-6-iodopyrazine-2-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Methyl 3-bromo-6-iodopyrazine-2-carboxylate (CAS 1093383-16-4) is a chemical compound with the molecular formula C6H4BrIN2O2 and a molecular weight of 342.92 g/mol. IUPAC name: methyl 3-bromo-6-iodopyrazine-2-carboxylate. InChIKey: BOEXWRBOBYLLMZ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H4BrIN2O2
Molecular weight342.92 g/mol
IUPAC namemethyl 3-bromo-6-iodopyrazine-2-carboxylate
InChIKeyBOEXWRBOBYLLMZ-UHFFFAOYSA-N
SMILESCOC(=O)C1=NC(=CN=C1Br)I

Computed by PubChem (NCBI)