CAS 1093396-57-6 appears in our catalog under these names: 1-Boc-4-isopropyl-4-piperidinecarboxylic acid, 95%, 1–Boc–4–isopropyl–4–piperidinecarboxylic Acid, 1-Boc-4-isopropyl-4-piperidinecarboxylic Acid, 1-(tert-Butoxycarbonyl)-4-isopropylpiperidine-4-carboxylic acid, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 2,5g.
1-[(2-methylpropan-2-yl)oxycarbonyl]-4-propan-2-ylpiperidine-4-carboxylic acid (CAS 1093396-57-6) is a chemical compound with the molecular formula C14H25NO4 and a molecular weight of 271.35 g/mol. IUPAC name: 1-[(2-methylpropan-2-yl)oxycarbonyl]-4-propan-2-ylpiperidine-4-carboxylic acid. InChIKey: HTQMWUMCFDOCLF-UHFFFAOYSA-N.
| Molecular formula | C14H25NO4 |
|---|---|
| Molecular weight | 271.35 g/mol |
| IUPAC name | 1-[(2-methylpropan-2-yl)oxycarbonyl]-4-propan-2-ylpiperidine-4-carboxylic acid |
| InChIKey | HTQMWUMCFDOCLF-UHFFFAOYSA-N |
| SMILES | CC(C)C1(CCN(CC1)C(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)