Products 1094253-67-4

CAS 1094253-67-4 appears in our catalog under these names: 3-Bromo-4-(2-methoxyethoxy)benzene-1-sulfonyl chloride, 95%, 3-Bromo-4-(2-methoxyethoxy)benzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.

3-bromo-4-(2-methoxyethoxy)benzenesulfonyl chloride (CAS 1094253-67-4) is a chemical compound with the molecular formula C9H10BrClO4S and a molecular weight of 329.60 g/mol. IUPAC name: 3-bromo-4-(2-methoxyethoxy)benzenesulfonyl chloride. InChIKey: JGNFIQCRKAISHH-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10BrClO4S
Molecular weight329.60 g/mol
IUPAC name3-bromo-4-(2-methoxyethoxy)benzenesulfonyl chloride
InChIKeyJGNFIQCRKAISHH-UHFFFAOYSA-N
SMILESCOCCOC1=C(C=C(C=C1)S(=O)(=O)Cl)Br

Computed by PubChem (NCBI)