CAS 1094253-67-4 appears in our catalog under these names: 3-Bromo-4-(2-methoxyethoxy)benzene-1-sulfonyl chloride, 95%, 3-Bromo-4-(2-methoxyethoxy)benzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
3-bromo-4-(2-methoxyethoxy)benzenesulfonyl chloride (CAS 1094253-67-4) is a chemical compound with the molecular formula C9H10BrClO4S and a molecular weight of 329.60 g/mol. IUPAC name: 3-bromo-4-(2-methoxyethoxy)benzenesulfonyl chloride. InChIKey: JGNFIQCRKAISHH-UHFFFAOYSA-N.
| Molecular formula | C9H10BrClO4S |
|---|---|
| Molecular weight | 329.60 g/mol |
| IUPAC name | 3-bromo-4-(2-methoxyethoxy)benzenesulfonyl chloride |
| InChIKey | JGNFIQCRKAISHH-UHFFFAOYSA-N |
| SMILES | COCCOC1=C(C=C(C=C1)S(=O)(=O)Cl)Br |
Computed by PubChem (NCBI)