Products 1247381-44-7

CAS 1247381-44-7 is the registry number for 5-Bromo-2-(2-methoxyethoxy)benzene-1-sulfonyl chloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

5-bromo-2-(2-methoxyethoxy)benzenesulfonyl chloride (CAS 1247381-44-7) is a chemical compound with the molecular formula C9H10BrClO4S and a molecular weight of 329.60 g/mol. IUPAC name: 5-bromo-2-(2-methoxyethoxy)benzenesulfonyl chloride. InChIKey: RDEKFBRAXHKEEV-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10BrClO4S
Molecular weight329.60 g/mol
IUPAC name5-bromo-2-(2-methoxyethoxy)benzenesulfonyl chloride
InChIKeyRDEKFBRAXHKEEV-UHFFFAOYSA-N
SMILESCOCCOC1=C(C=C(C=C1)Br)S(=O)(=O)Cl

Computed by PubChem (NCBI)