CAS 1094255-70-5 appears in our catalog under these names: 2-(3-(3-Chlorophenyl)-1,2,4-oxadiazol-5-yl)benzoic acid, 95%, 2-(3-(3-Chlorophenyl)-1,2,4-oxadiazol-5-yl)benzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]benzoic acid (CAS 1094255-70-5) is a chemical compound with the molecular formula C15H9ClN2O3 and a molecular weight of 300.69 g/mol. IUPAC name: 2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]benzoic acid. InChIKey: SIXMTRSELLHILQ-UHFFFAOYSA-N.
| Molecular formula | C15H9ClN2O3 |
|---|---|
| Molecular weight | 300.69 g/mol |
| IUPAC name | 2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]benzoic acid |
| InChIKey | SIXMTRSELLHILQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC(=NO2)C3=CC(=CC=C3)Cl)C(=O)O |
Computed by PubChem (NCBI)